C21H40 — CID 22142089
1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane (PubChem CID 22142089) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane.
| Compound Name | 1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane |
|---|---|
| PubChem CID | 22142089 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 1,1,5,5-tetramethyl-2-prop-1-en-2-yl-3-(2,2,4-trimethylpentyl)cyclohexane |
| SMILES | C=C(C)C1C(CC(C)(C)CC(C)C)CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C21H40/c1-15(2)11-19(5,6)12-17-13-20(7,8)14-21(9,10)18(17)16(3)4/h15,17-18H,3,11-14H2,1-2,4-10H3 |
| InChIKey | RKIRUWUUGLPTCW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|