About (3,4-dichlorophenyl)methyl pyridine-2-carboxylate
(3,4-dichlorophenyl)methyl pyridine-2-carboxylate (PubChem CID 2214216) has the molecular formula C13H9Cl2NO2
and a molecular weight of 282.13 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)methyl pyridine-2-carboxylate |
| PubChem CID | 2214216 |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | (3,4-dichlorophenyl)methyl pyridine-2-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c(Cl)c1)c1ccccn1 |
| InChI | InChI=1S/C13H9Cl2NO2/c14-10-5-4-9(7-11(10)15)8-18-13(17)12-3-1-2-6-16-12/h1-7H,8H2 |
| InChIKey | RWEIKSQLMMKJDJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-dichlorophenyl)methyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)methyl pyridine-2-carboxylate?
The IUPAC name of (3,4-dichlorophenyl)methyl pyridine-2-carboxylate (CID 2214216) is (3,4-dichlorophenyl)methyl pyridine-2-carboxylate.
What is the SMILES notation for (3,4-dichlorophenyl)methyl pyridine-2-carboxylate?
The canonical SMILES for (3,4-dichlorophenyl)methyl pyridine-2-carboxylate is O=C(OCc1ccc(Cl)c(Cl)c1)c1ccccn1.
What is the InChIKey of (3,4-dichlorophenyl)methyl pyridine-2-carboxylate?
The InChIKey is RWEIKSQLMMKJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO2/c14-10-5-4-9(7-11(10)15)8-18-13(17)12-3-1-2-6-16-12/h1-7H,8H2.
What are the key properties of (3,4-dichlorophenyl)methyl pyridine-2-carboxylate?
(3,4-dichlorophenyl)methyl pyridine-2-carboxylate has a molecular weight of 282.13 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)methyl pyridine-2-carboxylate is sourced from PubChem (CID 2214216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).