C7H11N5O2 — CID 22142380
6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine (PubChem CID 22142380) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 22142380 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine |
| SMILES | NCCNc1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C7H11N5O2/c8-3-4-10-6-2-1-5(12(13)14)7(9)11-6/h1-2H,3-4,8H2,(H3,9,10,11) |
| InChIKey | JNXKEBLSRILDQM-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|