C21H20ClN9O3 — CID 22142399
6-N-[2-[[4-(4-chloro-2-methoxyphenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 22142399) has the molecular formula C21H20ClN9O3 and a molecular weight of 481.90 g/mol. Its IUPAC name is 6-N-[2-[[4-(4-chloro-2-methoxyphenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[4-(4-chloro-2-methoxyphenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 22142399 |
| Molecular Formula | C21H20ClN9O3 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 6-N-[2-[[4-(4-chloro-2-methoxyphenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | COc1cc(Cl)ccc1-c1nc(NCCNc2ccc([N+](=O)[O-])c(N)n2)ncc1-c1ncc[nH]1 |
| InChI | InChI=1S/C21H20ClN9O3/c1-34-16-10-12(22)2-3-13(16)18-14(20-25-7-8-26-20)11-28-21(30-18)27-9-6-24-17-5-4-15(31(32)33)19(23)29-17/h2-5,7-8,10-11H,6,9H2,1H3,(H,25,26)(H3,23,24,29)(H,27,28,30) |
| InChIKey | UUHHGACRSBVCEZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|