C16H13Cl3N2O2 — CID 22142428
5-chloro-1-[(Z)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]pyridin-2-one (PubChem CID 22142428) has the molecular formula C16H13Cl3N2O2 and a molecular weight of 371.65 g/mol. Its IUPAC name is 5-chloro-1-[(Z)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]pyridin-2-one.
| Compound Name | 5-chloro-1-[(Z)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 22142428 |
| Molecular Formula | C16H13Cl3N2O2 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 5-chloro-1-[(Z)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]pyridin-2-one |
| SMILES | CN(C)/C=C(/C(=O)c1ccc(Cl)cc1Cl)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C16H13Cl3N2O2/c1-20(2)9-14(21-8-11(18)4-6-15(21)22)16(23)12-5-3-10(17)7-13(12)19/h3-9H,1-2H3/b14-9- |
| InChIKey | REKOXNZOZFKKFW-ZROIWOOFSA-N |
| XLogP | 4.05 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|