C21H17N9O3 — CID 22142456
4-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile (PubChem CID 22142456) has the molecular formula C21H17N9O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 4-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 22142456 |
| Molecular Formula | C21H17N9O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile |
| SMILES | Cc1noc(-c2cnc(NCCNc3ccc([N+](=O)[O-])cn3)nc2-c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C21H17N9O3/c1-13-27-20(33-29-13)17-12-26-21(28-19(17)15-4-2-14(10-22)3-5-15)24-9-8-23-18-7-6-16(11-25-18)30(31)32/h2-7,11-12H,8-9H2,1H3,(H,23,25)(H,24,26,28) |
| InChIKey | KNNBOVQAWVQXJM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|