C17H16Cl2N8O2 — CID 22142459
2-N-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethyl]-4-(2,4-dichlorophenyl)pyrimidine-2,5-diamine (PubChem CID 22142459) has the molecular formula C17H16Cl2N8O2 and a molecular weight of 435.28 g/mol. Its IUPAC name is 2-N-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethyl]-4-(2,4-dichlorophenyl)pyrimidine-2,5-diamine.
| Compound Name | 2-N-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethyl]-4-(2,4-dichlorophenyl)pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 22142459 |
| Molecular Formula | C17H16Cl2N8O2 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-N-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethyl]-4-(2,4-dichlorophenyl)pyrimidine-2,5-diamine |
| SMILES | Nc1cnc(NCCNc2ccc([N+](=O)[O-])c(N)n2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N8O2/c18-9-1-2-10(11(19)7-9)15-12(20)8-24-17(26-15)23-6-5-22-14-4-3-13(27(28)29)16(21)25-14/h1-4,7-8H,5-6,20H2,(H3,21,22,25)(H,23,24,26) |
| InChIKey | BVKXXBXPKLKPBC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 157.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|