C21H16Cl2N8 — CID 22142468
6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 22142468) has the molecular formula C21H16Cl2N8 and a molecular weight of 451.32 g/mol. Its IUPAC name is 6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22142468 |
| Molecular Formula | C21H16Cl2N8 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCNc2ncc(-c3ncc[nH]3)c(-c3ccc(Cl)cc3Cl)n2)nc1 |
| InChI | InChI=1S/C21H16Cl2N8/c22-14-2-3-15(17(23)9-14)19-16(20-26-6-7-27-20)12-30-21(31-19)28-8-5-25-18-4-1-13(10-24)11-29-18/h1-4,6-7,9,11-12H,5,8H2,(H,25,29)(H,26,27)(H,28,30,31) |
| InChIKey | QHRVOMUTPKEWTP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|