C26H31Cl2N9O4 — CID 22142685
tert-butyl 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]piperazine-1-carboxylate (PubChem CID 22142685) has the molecular formula C26H31Cl2N9O4 and a molecular weight of 604.50 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22142685 |
| Molecular Formula | C26H31Cl2N9O4 |
| Molecular Weight | 604.50 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | tert-butyl 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc(NCCNc3ccc([N+](=O)[O-])c(N)n3)nc2-c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C26H31Cl2N9O4/c1-26(2,3)41-25(38)36-12-10-35(11-13-36)20-15-32-24(34-22(20)17-5-4-16(27)14-18(17)28)31-9-8-30-21-7-6-19(37(39)40)23(29)33-21/h4-7,14-15H,8-13H2,1-3H3,(H3,29,30,33)(H,31,32,34) |
| InChIKey | DPWBFTPBPOHWSZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 164.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|