C25H29Cl2N9O4 — CID 22142714
N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-morpholin-4-ylbutanamide (PubChem CID 22142714) has the molecular formula C25H29Cl2N9O4 and a molecular weight of 590.47 g/mol. Its IUPAC name is N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-morpholin-4-ylbutanamide.
| Compound Name | N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 22142714 |
| Molecular Formula | C25H29Cl2N9O4 |
| Molecular Weight | 590.47 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-morpholin-4-ylbutanamide |
| SMILES | Nc1nc(NCCNc2ncc(NC(=O)CCCN3CCOCC3)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H29Cl2N9O4/c26-16-3-4-17(18(27)14-16)23-19(32-22(37)2-1-9-35-10-12-40-13-11-35)15-31-25(34-23)30-8-7-29-21-6-5-20(36(38)39)24(28)33-21/h3-6,14-15H,1-2,7-13H2,(H,32,37)(H3,28,29,33)(H,30,31,34) |
| InChIKey | SPXKYRFOPXOATB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 173.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|