C20H18ClN9O2 — CID 22142771
6-N-[2-[[4-(2-chlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 22142771) has the molecular formula C20H18ClN9O2 and a molecular weight of 451.88 g/mol. Its IUPAC name is 6-N-[2-[[4-(2-chlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[4-(2-chlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 22142771 |
| Molecular Formula | C20H18ClN9O2 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 6-N-[2-[[4-(2-chlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2ncc(-c3ncc[nH]3)c(-c3ccccc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18ClN9O2/c21-14-4-2-1-3-12(14)17-13(19-24-8-9-25-19)11-27-20(29-17)26-10-7-23-16-6-5-15(30(31)32)18(22)28-16/h1-6,8-9,11H,7,10H2,(H,24,25)(H3,22,23,28)(H,26,27,29) |
| InChIKey | ICSQPDLXYOKXPD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|