C26H30Cl2N8O4 — CID 22142789
tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]piperazine-1-carboxylate (PubChem CID 22142789) has the molecular formula C26H30Cl2N8O4 and a molecular weight of 589.48 g/mol. Its IUPAC name is tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22142789 |
| Molecular Formula | C26H30Cl2N8O4 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc(NCCNc3ccc([N+](=O)[O-])cn3)nc2-c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C26H30Cl2N8O4/c1-26(2,3)40-25(37)35-12-10-34(11-13-35)21-16-32-24(33-23(21)19-6-4-17(27)14-20(19)28)30-9-8-29-22-7-5-18(15-31-22)36(38)39/h4-7,14-16H,8-13H2,1-3H3,(H,29,31)(H,30,32,33) |
| InChIKey | CBMPUBBBAMWYHJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|