C21H22Cl2N8O3 — CID 22142818
6-N-[2-[[4-(2,4-dichlorophenyl)-5-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 22142818) has the molecular formula C21H22Cl2N8O3 and a molecular weight of 505.37 g/mol. Its IUPAC name is 6-N-[2-[[4-(2,4-dichlorophenyl)-5-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[4-(2,4-dichlorophenyl)-5-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 22142818 |
| Molecular Formula | C21H22Cl2N8O3 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 6-N-[2-[[4-(2,4-dichlorophenyl)-5-morpholin-4-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2ncc(N3CCOCC3)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22Cl2N8O3/c22-13-1-2-14(15(23)11-13)19-17(30-7-9-34-10-8-30)12-27-21(29-19)26-6-5-25-18-4-3-16(31(32)33)20(24)28-18/h1-4,11-12H,5-10H2,(H3,24,25,28)(H,26,27,29) |
| InChIKey | PMZOMVJSQDDQLV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|