C21H19Cl2N9O2 — CID 22142867
6-N-[2-[[4-(2,4-dichlorophenyl)-5-(5-methyl-1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 22142867) has the molecular formula C21H19Cl2N9O2 and a molecular weight of 500.35 g/mol. Its IUPAC name is 6-N-[2-[[4-(2,4-dichlorophenyl)-5-(5-methyl-1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[4-(2,4-dichlorophenyl)-5-(5-methyl-1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 22142867 |
| Molecular Formula | C21H19Cl2N9O2 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 6-N-[2-[[4-(2,4-dichlorophenyl)-5-(5-methyl-1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Cc1cnc(-c2cnc(NCCNc3ccc([N+](=O)[O-])c(N)n3)nc2-c2ccc(Cl)cc2Cl)[nH]1 |
| InChI | InChI=1S/C21H19Cl2N9O2/c1-11-9-27-20(29-11)14-10-28-21(31-18(14)13-3-2-12(22)8-15(13)23)26-7-6-25-17-5-4-16(32(33)34)19(24)30-17/h2-5,8-10H,6-7H2,1H3,(H,27,29)(H3,24,25,30)(H,26,28,31) |
| InChIKey | MRNCBXJQNVCGQK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|