C28H34Cl2N8O4 — CID 22142946
tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 22142946) has the molecular formula C28H34Cl2N8O4 and a molecular weight of 617.54 g/mol. Its IUPAC name is tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 22142946 |
| Molecular Formula | C28H34Cl2N8O4 |
| Molecular Weight | 617.54 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | tert-butyl 4-[4-(2,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2cnc(NCCNc3ccc([N+](=O)[O-])cn3)nc2-c2ccc(Cl)cc2Cl)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34Cl2N8O4/c1-17-15-36(16-18(2)37(17)27(39)42-28(3,4)5)23-14-34-26(35-25(23)21-8-6-19(29)12-22(21)30)32-11-10-31-24-9-7-20(13-33-24)38(40)41/h6-9,12-14,17-18H,10-11,15-16H2,1-5H3,(H,31,33)(H,32,34,35) |
| InChIKey | HHXQFYFJLIGXSG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|