C21H23Cl2N9O3 — CID 22142983
N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-2-(dimethylamino)acetamide (PubChem CID 22142983) has the molecular formula C21H23Cl2N9O3 and a molecular weight of 520.38 g/mol. Its IUPAC name is N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-2-(dimethylamino)acetamide.
| Compound Name | N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 22142983 |
| Molecular Formula | C21H23Cl2N9O3 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1cnc(NCCNc2ccc([N+](=O)[O-])c(N)n2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N9O3/c1-31(2)11-18(33)28-15-10-27-21(30-19(15)13-4-3-12(22)9-14(13)23)26-8-7-25-17-6-5-16(32(34)35)20(24)29-17/h3-6,9-10H,7-8,11H2,1-2H3,(H,28,33)(H3,24,25,29)(H,26,27,30) |
| InChIKey | CQPSXCWKTFVIMO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|