C24H27Cl2N8O3- — CID 22143094
1-[6-[2-[[6-amino-5-[hydroxy(oxido)amino]-2-pyridinyl]amino]ethylamino]-2-(2,4-dichlorophenyl)-3-pyridinyl]-4-ethylpiperazin-2-one (PubChem CID 22143094) has the molecular formula C24H27Cl2N8O3- and a molecular weight of 546.44 g/mol. Its IUPAC name is 1-[6-[2-[[6-amino-5-[hydroxy(oxido)amino]-2-pyridinyl]amino]ethylamino]-2-(2,4-dichlorophenyl)-3-pyridinyl]-4-ethylpiperazin-2-one.
| Compound Name | 1-[6-[2-[[6-amino-5-[hydroxy(oxido)amino]-2-pyridinyl]amino]ethylamino]-2-(2,4-dichlorophenyl)-3-pyridinyl]-4-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 22143094 |
| Molecular Formula | C24H27Cl2N8O3- |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 1-[6-[2-[[6-amino-5-[hydroxy(oxido)amino]-2-pyridinyl]amino]ethylamino]-2-(2,4-dichlorophenyl)-3-pyridinyl]-4-ethylpiperazin-2-one |
| SMILES | CCN1CCN(c2ccc(NCCNc3ccc(N([O-])O)c(N)n3)nc2-c2ccc(Cl)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C24H27Cl2N8O3/c1-2-32-11-12-33(22(35)14-32)18-5-7-20(30-23(18)16-4-3-15(25)13-17(16)26)28-9-10-29-21-8-6-19(34(36)37)24(27)31-21/h3-8,13,36H,2,9-12,14H2,1H3,(H,28,30)(H3,27,29,31)/q-1 |
| InChIKey | XJVGKPXVDBONSD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|