About 4-chloro-1,2,3,4-tetrahydroquinazoline
4-chloro-1,2,3,4-tetrahydroquinazoline (PubChem CID 22143447) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is 4-chloro-1,2,3,4-tetrahydroquinazoline.
Molecular Properties
| Compound Name | 4-chloro-1,2,3,4-tetrahydroquinazoline |
| PubChem CID | 22143447 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 4-chloro-1,2,3,4-tetrahydroquinazoline |
| SMILES | ClC1NCNc2ccccc21 |
| InChI | InChI=1S/C8H9ClN2/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-4,8,10-11H,5H2 |
| InChIKey | HMNZJSPRBWSKJG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,2,3,4-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,2,3,4-tetrahydroquinazoline?
The IUPAC name of 4-chloro-1,2,3,4-tetrahydroquinazoline (CID 22143447) is 4-chloro-1,2,3,4-tetrahydroquinazoline.
What is the SMILES notation for 4-chloro-1,2,3,4-tetrahydroquinazoline?
The canonical SMILES for 4-chloro-1,2,3,4-tetrahydroquinazoline is ClC1NCNc2ccccc21.
What is the InChIKey of 4-chloro-1,2,3,4-tetrahydroquinazoline?
The InChIKey is HMNZJSPRBWSKJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-4,8,10-11H,5H2.
What are the key properties of 4-chloro-1,2,3,4-tetrahydroquinazoline?
4-chloro-1,2,3,4-tetrahydroquinazoline has a molecular weight of 168.63 g/mol, XLogP of 1.90, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,2,3,4-tetrahydroquinazoline is sourced from PubChem (CID 22143447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).