C15H20N2O2 — CID 22143555
6-hydroxy-1,2-dimethyl-N-(2-methylpropyl)indole-3-carboxamide (PubChem CID 22143555) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-hydroxy-1,2-dimethyl-N-(2-methylpropyl)indole-3-carboxamide.
| Compound Name | 6-hydroxy-1,2-dimethyl-N-(2-methylpropyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 22143555 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 6-hydroxy-1,2-dimethyl-N-(2-methylpropyl)indole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCC(C)C)c2ccc(O)cc2n1C |
| InChI | InChI=1S/C15H20N2O2/c1-9(2)8-16-15(19)14-10(3)17(4)13-7-11(18)5-6-12(13)14/h5-7,9,18H,8H2,1-4H3,(H,16,19) |
| InChIKey | YEDLUSPFNVLIRI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |