About 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid
2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 22143586) has the molecular formula C11H5ClN2O2S2
and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 22143586 |
| Molecular Formula | C11H5ClN2O2S2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2cc3nccc(Cl)c3s2)n1 |
| InChI | InChI=1S/C11H5ClN2O2S2/c12-5-1-2-13-6-3-8(18-9(5)6)10-14-7(4-17-10)11(15)16/h1-4H,(H,15,16) |
| InChIKey | UMPASXGMRYHSBB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid (CID 22143586) is 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(-c2cc3nccc(Cl)c3s2)n1.
What is the InChIKey of 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is UMPASXGMRYHSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5ClN2O2S2/c12-5-1-2-13-6-3-8(18-9(5)6)10-14-7(4-17-10)11(15)16/h1-4H,(H,15,16).
What are the key properties of 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid?
2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 296.76 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chlorothieno[3,2-b]pyridin-2-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 22143586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).