About (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone
(7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 22143587) has the molecular formula C14H15ClN2O2S
and a molecular weight of 310.81 g/mol. Its IUPAC name is (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 22143587 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COCC1CCCN1C(=O)c1cc2nccc(Cl)c2s1 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-19-8-9-3-2-6-17(9)14(18)12-7-11-13(20-12)10(15)4-5-16-11/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | JZVXCSRSYPZURP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone?
The IUPAC name of (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone (CID 22143587) is (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone is COCC1CCCN1C(=O)c1cc2nccc(Cl)c2s1.
What is the InChIKey of (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone?
The InChIKey is JZVXCSRSYPZURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O2S/c1-19-8-9-3-2-6-17(9)14(18)12-7-11-13(20-12)10(15)4-5-16-11/h4-5,7,9H,2-3,6,8H2,1H3.
What are the key properties of (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone?
(7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone has a molecular weight of 310.81 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chlorothieno[3,2-b]pyridin-2-yl)-[2-(methoxymethyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 22143587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).