C17H24N2O6 — CID 22143921
2-[carboxy-[2-[(3-methoxybenzoyl)amino]ethyl]amino]-4-methylpentanoic acid (PubChem CID 22143921) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[carboxy-[2-[(3-methoxybenzoyl)amino]ethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[carboxy-[2-[(3-methoxybenzoyl)amino]ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22143921 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[carboxy-[2-[(3-methoxybenzoyl)amino]ethyl]amino]-4-methylpentanoic acid |
| SMILES | COc1cccc(C(=O)NCCN(C(=O)O)C(CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C17H24N2O6/c1-11(2)9-14(16(21)22)19(17(23)24)8-7-18-15(20)12-5-4-6-13(10-12)25-3/h4-6,10-11,14H,7-9H2,1-3H3,(H,18,20)(H,21,22)(H,23,24) |
| InChIKey | ACJVBFLATMPECP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |