C25H23N3O2 — CID 2214445
propan-2-yl 4-[(3,5-diphenyl-1,2,4-triazol-4-yl)methyl]benzoate (PubChem CID 2214445) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is propan-2-yl 4-[(3,5-diphenyl-1,2,4-triazol-4-yl)methyl]benzoate.
| Compound Name | propan-2-yl 4-[(3,5-diphenyl-1,2,4-triazol-4-yl)methyl]benzoate |
|---|---|
| PubChem CID | 2214445 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | propan-2-yl 4-[(3,5-diphenyl-1,2,4-triazol-4-yl)methyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(Cn2c(-c3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O2/c1-18(2)30-25(29)22-15-13-19(14-16-22)17-28-23(20-9-5-3-6-10-20)26-27-24(28)21-11-7-4-8-12-21/h3-16,18H,17H2,1-2H3 |
| InChIKey | FUFHJCHKIOQVAV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |