About 2-methylprop-1-ene;pyrrolidine-2,5-dione
2-methylprop-1-ene;pyrrolidine-2,5-dione (PubChem CID 22145183) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-methylprop-1-ene;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;pyrrolidine-2,5-dione |
| PubChem CID | 22145183 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-methylprop-1-ene;pyrrolidine-2,5-dione |
| SMILES | C=C(C)C.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C4H8/c6-3-1-2-4(7)5-3;1-4(2)3/h1-2H2,(H,5,6,7);1H2,2-3H3 |
| InChIKey | GNLLVGLBEKGLTI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;pyrrolidine-2,5-dione?
The IUPAC name of 2-methylprop-1-ene;pyrrolidine-2,5-dione (CID 22145183) is 2-methylprop-1-ene;pyrrolidine-2,5-dione.
What is the SMILES notation for 2-methylprop-1-ene;pyrrolidine-2,5-dione?
The canonical SMILES for 2-methylprop-1-ene;pyrrolidine-2,5-dione is C=C(C)C.O=C1CCC(=O)N1.
What is the InChIKey of 2-methylprop-1-ene;pyrrolidine-2,5-dione?
The InChIKey is GNLLVGLBEKGLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C4H8/c6-3-1-2-4(7)5-3;1-4(2)3/h1-2H2,(H,5,6,7);1H2,2-3H3.
What are the key properties of 2-methylprop-1-ene;pyrrolidine-2,5-dione?
2-methylprop-1-ene;pyrrolidine-2,5-dione has a molecular weight of 155.20 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;pyrrolidine-2,5-dione is sourced from PubChem (CID 22145183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).