About 5-ethenoxytridecane
5-ethenoxytridecane (PubChem CID 22145314) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 5-ethenoxytridecane.
Molecular Properties
| Compound Name | 5-ethenoxytridecane |
| PubChem CID | 22145314 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 5-ethenoxytridecane |
| SMILES | C=COC(CCCC)CCCCCCCC |
| InChI | InChI=1S/C15H30O/c1-4-7-9-10-11-12-14-15(16-6-3)13-8-5-2/h6,15H,3-5,7-14H2,1-2H3 |
| InChIKey | KFTIMAXIPQBYFG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenoxytridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenoxytridecane?
The IUPAC name of 5-ethenoxytridecane (CID 22145314) is 5-ethenoxytridecane.
What is the SMILES notation for 5-ethenoxytridecane?
The canonical SMILES for 5-ethenoxytridecane is C=COC(CCCC)CCCCCCCC.
What is the InChIKey of 5-ethenoxytridecane?
The InChIKey is KFTIMAXIPQBYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-4-7-9-10-11-12-14-15(16-6-3)13-8-5-2/h6,15H,3-5,7-14H2,1-2H3.
What are the key properties of 5-ethenoxytridecane?
5-ethenoxytridecane has a molecular weight of 226.40 g/mol, XLogP of 5.46, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenoxytridecane is sourced from PubChem (CID 22145314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).