About benzo[d][2,1]benzothiazepine
benzo[d][2,1]benzothiazepine (PubChem CID 22145432) has the molecular formula C13H9NS
and a molecular weight of 211.29 g/mol. Its IUPAC name is benzo[d][2,1]benzothiazepine.
Molecular Properties
| Compound Name | benzo[d][2,1]benzothiazepine |
| PubChem CID | 22145432 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | benzo[d][2,1]benzothiazepine |
| SMILES | C1=c2ccccc2=c2ccccc2=NS1 |
| InChI | InChI=1S/C13H9NS/c1-2-6-11-10(5-1)9-15-14-13-8-4-3-7-12(11)13/h1-9H |
| InChIKey | RCZNTCRHZYKQIC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzo[d][2,1]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[d][2,1]benzothiazepine?
The IUPAC name of benzo[d][2,1]benzothiazepine (CID 22145432) is benzo[d][2,1]benzothiazepine.
What is the SMILES notation for benzo[d][2,1]benzothiazepine?
The canonical SMILES for benzo[d][2,1]benzothiazepine is C1=c2ccccc2=c2ccccc2=NS1.
What is the InChIKey of benzo[d][2,1]benzothiazepine?
The InChIKey is RCZNTCRHZYKQIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS/c1-2-6-11-10(5-1)9-15-14-13-8-4-3-7-12(11)13/h1-9H.
What are the key properties of benzo[d][2,1]benzothiazepine?
benzo[d][2,1]benzothiazepine has a molecular weight of 211.29 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[d][2,1]benzothiazepine is sourced from PubChem (CID 22145432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).