C18H24O3 — CID 22145500
(2E,4E,6E,8E,10Z)-11-(5,5-dimethyl-1,3-dioxan-2-yl)dodeca-2,4,6,8,10-pentaenal (PubChem CID 22145500) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2E,4E,6E,8E,10Z)-11-(5,5-dimethyl-1,3-dioxan-2-yl)dodeca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10Z)-11-(5,5-dimethyl-1,3-dioxan-2-yl)dodeca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 22145500 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2E,4E,6E,8E,10Z)-11-(5,5-dimethyl-1,3-dioxan-2-yl)dodeca-2,4,6,8,10-pentaenal |
| SMILES | C/C(=C/C=C/C=C/C=C/C=C/C=O)C1OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H24O3/c1-16(17-20-14-18(2,3)15-21-17)12-10-8-6-4-5-7-9-11-13-19/h4-13,17H,14-15H2,1-3H3/b6-4+,7-5+,10-8+,11-9+,16-12- |
| InChIKey | UUVRSXPCBPYQLF-RVXPQKMKSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|