About 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide
5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide (PubChem CID 22145901) has the molecular formula C18H17F3N2O3
and a molecular weight of 366.34 g/mol. Its IUPAC name is 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide.
Molecular Properties
| Compound Name | 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide |
| PubChem CID | 22145901 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide |
| SMILES | COc1cc(F)c(C(=O)Nc2c(F)cncc2F)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-25-15-7-12(19)11(6-16(15)26-10-4-2-3-5-10)18(24)23-17-13(20)8-22-9-14(17)21/h6-10H,2-5H2,1H3,(H,22,23,24) |
| InChIKey | ZUGGUXQTMNSNQD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide?
The IUPAC name of 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide (CID 22145901) is 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide.
What is the SMILES notation for 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide?
The canonical SMILES for 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide is COc1cc(F)c(C(=O)Nc2c(F)cncc2F)cc1OC1CCCC1.
What is the InChIKey of 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide?
The InChIKey is ZUGGUXQTMNSNQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N2O3/c1-25-15-7-12(19)11(6-16(15)26-10-4-2-3-5-10)18(24)23-17-13(20)8-22-9-14(17)21/h6-10H,2-5H2,1H3,(H,22,23,24).
What are the key properties of 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide?
5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide has a molecular weight of 366.34 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyloxy-N-(3,5-difluoro-4-pyridinyl)-2-fluoro-4-methoxybenzamide is sourced from PubChem (CID 22145901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).