About azane;1-ethylpyrrolidin-2-one
azane;1-ethylpyrrolidin-2-one (PubChem CID 22146146) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is azane;1-ethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | azane;1-ethylpyrrolidin-2-one |
| PubChem CID | 22146146 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | azane;1-ethylpyrrolidin-2-one |
| SMILES | CCN1CCCC1=O.N |
| InChI | InChI=1S/C6H11NO.H3N/c1-2-7-5-3-4-6(7)8;/h2-5H2,1H3;1H3 |
| InChIKey | UHSGIQZSVIMFEK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1-ethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethylpyrrolidin-2-one?
The IUPAC name of azane;1-ethylpyrrolidin-2-one (CID 22146146) is azane;1-ethylpyrrolidin-2-one.
What is the SMILES notation for azane;1-ethylpyrrolidin-2-one?
The canonical SMILES for azane;1-ethylpyrrolidin-2-one is CCN1CCCC1=O.N.
What is the InChIKey of azane;1-ethylpyrrolidin-2-one?
The InChIKey is UHSGIQZSVIMFEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.H3N/c1-2-7-5-3-4-6(7)8;/h2-5H2,1H3;1H3.
What are the key properties of azane;1-ethylpyrrolidin-2-one?
azane;1-ethylpyrrolidin-2-one has a molecular weight of 130.19 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethylpyrrolidin-2-one is sourced from PubChem (CID 22146146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).