About [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol
[2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol (PubChem CID 22146242) has the molecular formula C24H26O2
and a molecular weight of 346.47 g/mol. Its IUPAC name is [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol |
| PubChem CID | 22146242 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol |
| SMILES | Cc1ccc(C)c(-c2cc(CO)c(-c3cc(C)ccc3C)cc2CO)c1 |
| InChI | InChI=1S/C24H26O2/c1-15-5-7-17(3)21(9-15)23-11-20(14-26)24(12-19(23)13-25)22-10-16(2)6-8-18(22)4/h5-12,25-26H,13-14H2,1-4H3 |
| InChIKey | HDSDCODHVXRYBB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol?
The IUPAC name of [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol (CID 22146242) is [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol.
What is the SMILES notation for [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol?
The canonical SMILES for [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol is Cc1ccc(C)c(-c2cc(CO)c(-c3cc(C)ccc3C)cc2CO)c1.
What is the InChIKey of [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol?
The InChIKey is HDSDCODHVXRYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O2/c1-15-5-7-17(3)21(9-15)23-11-20(14-26)24(12-19(23)13-25)22-10-16(2)6-8-18(22)4/h5-12,25-26H,13-14H2,1-4H3.
What are the key properties of [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol?
[2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol has a molecular weight of 346.47 g/mol, XLogP of 5.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-bis(2,5-dimethylphenyl)-4-(hydroxymethyl)phenyl]methanol is sourced from PubChem (CID 22146242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).