About 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide
2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 2214635) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
Molecular Properties
| Compound Name | 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| PubChem CID | 2214635 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | CCCCOc1cccc(OCCCC)c1C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C19H26N2O4/c1-4-6-11-23-15-9-8-10-16(24-12-7-5-2)18(15)19(22)20-17-13-14(3)25-21-17/h8-10,13H,4-7,11-12H2,1-3H3,(H,20,21,22) |
| InChIKey | RVPRJTOEUWYJDA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
The IUPAC name of 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide (CID 2214635) is 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
What is the SMILES notation for 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
The canonical SMILES for 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide is CCCCOc1cccc(OCCCC)c1C(=O)Nc1cc(C)on1.
What is the InChIKey of 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
The InChIKey is RVPRJTOEUWYJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-4-6-11-23-15-9-8-10-16(24-12-7-5-2)18(15)19(22)20-17-13-14(3)25-21-17/h8-10,13H,4-7,11-12H2,1-3H3,(H,20,21,22).
What are the key properties of 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide has a molecular weight of 346.43 g/mol, XLogP of 4.59, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibutoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide is sourced from PubChem (CID 2214635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).