C42H18Cl12N4 — CID 22146464
2,4,5-tris(2,4-dichlorophenyl)-2-[2,4,5-tris(2,4-dichlorophenyl)imidazol-2-yl]imidazole (PubChem CID 22146464) has the molecular formula C42H18Cl12N4 and a molecular weight of 1004.07 g/mol. Its IUPAC name is 2,4,5-tris(2,4-dichlorophenyl)-2-[2,4,5-tris(2,4-dichlorophenyl)imidazol-2-yl]imidazole.
| Compound Name | 2,4,5-tris(2,4-dichlorophenyl)-2-[2,4,5-tris(2,4-dichlorophenyl)imidazol-2-yl]imidazole |
|---|---|
| PubChem CID | 22146464 |
| Molecular Formula | C42H18Cl12N4 |
| Molecular Weight | 1004.07 g/mol |
| Exact Mass | 997.78 |
| IUPAC Name | 2,4,5-tris(2,4-dichlorophenyl)-2-[2,4,5-tris(2,4-dichlorophenyl)imidazol-2-yl]imidazole |
| SMILES | Clc1ccc(C2=NC(c3ccc(Cl)cc3Cl)(C3(c4ccc(Cl)cc4Cl)N=C(c4ccc(Cl)cc4Cl)C(c4ccc(Cl)cc4Cl)=N3)N=C2c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C42H18Cl12N4/c43-19-1-7-25(31(49)13-19)37-38(26-8-2-20(44)14-32(26)50)56-41(55-37,29-11-5-23(47)17-35(29)53)42(30-12-6-24(48)18-36(30)54)57-39(27-9-3-21(45)15-33(27)51)40(58-42)28-10-4-22(46)16-34(28)52/h1-18H |
| InChIKey | PLQHCTVWFWTHOX-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.07 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |