C40H58O4Zn — CID 22146572
zinc bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate) (PubChem CID 22146572) has the molecular formula C40H58O4Zn and a molecular weight of 668.29 g/mol. Its IUPAC name is zinc bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate).
| Compound Name | zinc bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate) |
|---|---|
| PubChem CID | 22146572 |
| Molecular Formula | C40H58O4Zn |
| Molecular Weight | 668.29 g/mol |
| Exact Mass | 666.36 |
| IUPAC Name | zinc bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate) |
| SMILES | CC(C)C1=CC2=CCC3C(C)(C(=O)[O-])CCCC3(C)C2CC1.CC(C)C1=CC2=CCC3C(C)(C(=O)[O-])CCCC3(C)C2CC1.[Zn+2] |
| InChI | InChI=1S/2C20H30O2.Zn/c2*1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22;/h2*7,12-13,16-17H,5-6,8-11H2,1-4H3,(H,21,22);/q;;+2/p-2 |
| InChIKey | MXODCLTZTIFYDV-UHFFFAOYSA-L |
| XLogP | 7.74 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.29 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|