About 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one
7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one (PubChem CID 22146611) has the molecular formula C10H8F3NOS
and a molecular weight of 247.24 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one |
| PubChem CID | 22146611 |
| Molecular Formula | C10H8F3NOS |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one |
| SMILES | O=C1CSCc2cc(C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C10H8F3NOS/c11-10(12,13)7-1-2-8-6(3-7)4-16-5-9(15)14-8/h1-3H,4-5H2,(H,14,15) |
| InChIKey | VNXWIRMGZVRPNT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one?
The IUPAC name of 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one (CID 22146611) is 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one.
What is the SMILES notation for 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one?
The canonical SMILES for 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one is O=C1CSCc2cc(C(F)(F)F)ccc2N1.
What is the InChIKey of 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one?
The InChIKey is VNXWIRMGZVRPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NOS/c11-10(12,13)7-1-2-8-6(3-7)4-16-5-9(15)14-8/h1-3H,4-5H2,(H,14,15).
What are the key properties of 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one?
7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one has a molecular weight of 247.24 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-1,5-dihydro-4,1-benzothiazepin-2-one is sourced from PubChem (CID 22146611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).