About cyclohexane-1,4-dione;ethene
cyclohexane-1,4-dione;ethene (PubChem CID 22146617) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is cyclohexane-1,4-dione;ethene.
Molecular Properties
| Compound Name | cyclohexane-1,4-dione;ethene |
| PubChem CID | 22146617 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | cyclohexane-1,4-dione;ethene |
| SMILES | C=C.O=C1CCC(=O)CC1 |
| InChI | InChI=1S/C6H8O2.C2H4/c7-5-1-2-6(8)4-3-5;1-2/h1-4H2;1-2H2 |
| InChIKey | AFRHZIJMWXFWKP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,4-dione;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,4-dione;ethene?
The IUPAC name of cyclohexane-1,4-dione;ethene (CID 22146617) is cyclohexane-1,4-dione;ethene.
What is the SMILES notation for cyclohexane-1,4-dione;ethene?
The canonical SMILES for cyclohexane-1,4-dione;ethene is C=C.O=C1CCC(=O)CC1.
What is the InChIKey of cyclohexane-1,4-dione;ethene?
The InChIKey is AFRHZIJMWXFWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C2H4/c7-5-1-2-6(8)4-3-5;1-2/h1-4H2;1-2H2.
What are the key properties of cyclohexane-1,4-dione;ethene?
cyclohexane-1,4-dione;ethene has a molecular weight of 140.18 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,4-dione;ethene is sourced from PubChem (CID 22146617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).