C24H29N3O2 — CID 22146630
ethane;3-methoxy-N-phenyl-2-piperidin-1-ylquinoline-4-carboxamide (PubChem CID 22146630) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is ethane;3-methoxy-N-phenyl-2-piperidin-1-ylquinoline-4-carboxamide.
| Compound Name | ethane;3-methoxy-N-phenyl-2-piperidin-1-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22146630 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethane;3-methoxy-N-phenyl-2-piperidin-1-ylquinoline-4-carboxamide |
| SMILES | CC.COc1c(N2CCCCC2)nc2ccccc2c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H23N3O2.C2H6/c1-27-20-19(22(26)23-16-10-4-2-5-11-16)17-12-6-7-13-18(17)24-21(20)25-14-8-3-9-15-25;1-2/h2,4-7,10-13H,3,8-9,14-15H2,1H3,(H,23,26);1-2H3 |
| InChIKey | VNBMQYDGHZLPKH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |