C26H31N3O — CID 22146632
2-[cyclopropylmethyl(propyl)amino]-N-(1-phenylpropyl)quinoline-4-carboxamide (PubChem CID 22146632) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[cyclopropylmethyl(propyl)amino]-N-(1-phenylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-[cyclopropylmethyl(propyl)amino]-N-(1-phenylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 22146632 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 2-[cyclopropylmethyl(propyl)amino]-N-(1-phenylpropyl)quinoline-4-carboxamide |
| SMILES | CCCN(CC1CC1)c1cc(C(=O)NC(CC)c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H31N3O/c1-3-16-29(18-19-14-15-19)25-17-22(21-12-8-9-13-24(21)27-25)26(30)28-23(4-2)20-10-6-5-7-11-20/h5-13,17,19,23H,3-4,14-16,18H2,1-2H3,(H,28,30) |
| InChIKey | ZCJOLKYYVBMGLC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |