C22H16FN5O4S — CID 22147080
[2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate (PubChem CID 22147080) has the molecular formula C22H16FN5O4S and a molecular weight of 465.47 g/mol. Its IUPAC name is [2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate.
| Compound Name | [2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 22147080 |
| Molecular Formula | C22H16FN5O4S |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | [2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylamino]-3H-benzimidazol-5-yl] 4-fluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc2nc(NCc3nc(-c4ccccc4)no3)[nH]c2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN5O4S/c23-15-6-9-17(10-7-15)33(29,30)32-16-8-11-18-19(12-16)26-22(25-18)24-13-20-27-21(28-31-20)14-4-2-1-3-5-14/h1-12H,13H2,(H2,24,25,26) |
| InChIKey | ABMXIFAYGHZCEK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|