C19H19BrF3N3O2S2 — CID 22147984
5'-(5-bromo-1,3-thiazol-2-yl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 22147984) has the molecular formula C19H19BrF3N3O2S2 and a molecular weight of 522.41 g/mol. Its IUPAC name is 5'-(5-bromo-1,3-thiazol-2-yl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | 5'-(5-bromo-1,3-thiazol-2-yl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 22147984 |
| Molecular Formula | C19H19BrF3N3O2S2 |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | 5'-(5-bromo-1,3-thiazol-2-yl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | O=S1(=O)NC2(CN1CC(F)(F)F)C1CCC2Cc2cc(-c3ncc(Br)s3)ccc2C1 |
| InChI | InChI=1S/C19H19BrF3N3O2S2/c20-16-8-24-17(29-16)12-2-1-11-6-14-3-4-15(7-13(11)5-12)18(14)9-26(10-19(21,22)23)30(27,28)25-18/h1-2,5,8,14-15,25H,3-4,6-7,9-10H2 |
| InChIKey | UEOOVASRERTMJG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |