About (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine
(5Z,7Z,9Z)-pyrrolo[1,2-a]azocine (PubChem CID 22149034) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine.
Molecular Properties
| Compound Name | (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine |
| PubChem CID | 22149034 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine |
| SMILES | C1=C\C=C/n2cccc2\C=C/1 |
| InChI | InChI=1S/C10H9N/c1-2-4-8-11-9-5-7-10(11)6-3-1/h1-9H/b2-1-,6-3-,8-4- |
| InChIKey | GNJJANNAHOJZGD-DRMPINAISA-N |
| XLogP | 2.54 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine?
The IUPAC name of (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine (CID 22149034) is (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine.
What is the SMILES notation for (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine?
The canonical SMILES for (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine is C1=C\C=C/n2cccc2\C=C/1.
What is the InChIKey of (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine?
The InChIKey is GNJJANNAHOJZGD-DRMPINAISA-N. The full InChI is InChI=1S/C10H9N/c1-2-4-8-11-9-5-7-10(11)6-3-1/h1-9H/b2-1-,6-3-,8-4-.
What are the key properties of (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine?
(5Z,7Z,9Z)-pyrrolo[1,2-a]azocine has a molecular weight of 143.19 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7Z,9Z)-pyrrolo[1,2-a]azocine is sourced from PubChem (CID 22149034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).