About N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine
N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine (PubChem CID 22149161) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine |
| PubChem CID | 22149161 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine |
| SMILES | CC(C)C(C)(C)NC(C)(C)C(C)C |
| InChI | InChI=1S/C12H27N/c1-9(2)11(5,6)13-12(7,8)10(3)4/h9-10,13H,1-8H3 |
| InChIKey | FSUMEIRCHVLSFK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine?
The IUPAC name of N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine (CID 22149161) is N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine.
What is the SMILES notation for N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine?
The canonical SMILES for N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine is CC(C)C(C)(C)NC(C)(C)C(C)C.
What is the InChIKey of N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine?
The InChIKey is FSUMEIRCHVLSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N/c1-9(2)11(5,6)13-12(7,8)10(3)4/h9-10,13H,1-8H3.
What are the key properties of N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine?
N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine has a molecular weight of 185.35 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylbutan-2-yl)-2,3-dimethylbutan-2-amine is sourced from PubChem (CID 22149161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).