About 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol
4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 22149164) has the molecular formula C20H23BrFNO2
and a molecular weight of 408.31 g/mol. Its IUPAC name is 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol.
Molecular Properties
| Compound Name | 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| PubChem CID | 22149164 |
| Molecular Formula | C20H23BrFNO2 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CCc1ccc2c(c1)C(NCc1ccc(F)c(Br)c1)C(O)C(C)(C)O2 |
| InChI | InChI=1S/C20H23BrFNO2/c1-4-12-6-8-17-14(9-12)18(19(24)20(2,3)25-17)23-11-13-5-7-16(22)15(21)10-13/h5-10,18-19,23-24H,4,11H2,1-3H3 |
| InChIKey | OEZHELVNUGTIOZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol?
The IUPAC name of 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol (CID 22149164) is 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol.
What is the SMILES notation for 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol?
The canonical SMILES for 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol is CCc1ccc2c(c1)C(NCc1ccc(F)c(Br)c1)C(O)C(C)(C)O2.
What is the InChIKey of 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol?
The InChIKey is OEZHELVNUGTIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrFNO2/c1-4-12-6-8-17-14(9-12)18(19(24)20(2,3)25-17)23-11-13-5-7-16(22)15(21)10-13/h5-10,18-19,23-24H,4,11H2,1-3H3.
What are the key properties of 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol?
4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol has a molecular weight of 408.31 g/mol, XLogP of 4.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-4-fluorophenyl)methylamino]-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-3-ol is sourced from PubChem (CID 22149164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).