About bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide
bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide (PubChem CID 22149260) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide |
| PubChem CID | 22149260 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide |
| SMILES | C1=CC2=CC=C1C2.N#CN |
| InChI | InChI=1S/C7H6.CH2N2/c1-2-7-4-3-6(1)5-7;2-1-3/h1-4H,5H2;2H2 |
| InChIKey | FFBWOHZZCFOMFD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide?
The IUPAC name of bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide (CID 22149260) is bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide.
What is the SMILES notation for bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide?
The canonical SMILES for bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide is C1=CC2=CC=C1C2.N#CN.
What is the InChIKey of bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide?
The InChIKey is FFBWOHZZCFOMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.CH2N2/c1-2-7-4-3-6(1)5-7;2-1-3/h1-4H,5H2;2H2.
What are the key properties of bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide?
bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide has a molecular weight of 132.17 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hepta-1,3,5-triene;cyanamide is sourced from PubChem (CID 22149260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).