About 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide
2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide (PubChem CID 22149271) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide.
Molecular Properties
| Compound Name | 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide |
| PubChem CID | 22149271 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N/C(N)=N/CCCCc1ccccc1 |
| InChI | InChI=1S/C19H23N3O/c1-15-9-5-6-13-17(15)18(23)22-19(20)21-14-8-7-12-16-10-3-2-4-11-16/h2-6,9-11,13H,7-8,12,14H2,1H3,(H3,20,21,22,23) |
| InChIKey | ARBHZAIGPOZDTK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide?
The IUPAC name of 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide (CID 22149271) is 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide.
What is the SMILES notation for 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide?
The canonical SMILES for 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide is Cc1ccccc1C(=O)N/C(N)=N/CCCCc1ccccc1.
What is the InChIKey of 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide?
The InChIKey is ARBHZAIGPOZDTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O/c1-15-9-5-6-13-17(15)18(23)22-19(20)21-14-8-7-12-16-10-3-2-4-11-16/h2-6,9-11,13H,7-8,12,14H2,1H3,(H3,20,21,22,23).
What are the key properties of 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide?
2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide has a molecular weight of 309.41 g/mol, XLogP of 3.06, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide is sourced from PubChem (CID 22149271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).