C14H15N3OS2 — CID 22149275
N-[amino-(N-methyl-3-methylsulfanylanilino)methylidene]thiophene-2-carboxamide (PubChem CID 22149275) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is N-[amino-(N-methyl-3-methylsulfanylanilino)methylidene]thiophene-2-carboxamide.
| Compound Name | N-[amino-(N-methyl-3-methylsulfanylanilino)methylidene]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22149275 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-[amino-(N-methyl-3-methylsulfanylanilino)methylidene]thiophene-2-carboxamide |
| SMILES | CSc1cccc(N(C)/C(N)=N/C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H15N3OS2/c1-17(10-5-3-6-11(9-10)19-2)14(15)16-13(18)12-7-4-8-20-12/h3-9H,1-2H3,(H2,15,16,18) |
| InChIKey | VNDZJTDROPCLHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|