C20H25N3O — CID 22149344
4-methyl-N-[N'-(5-phenylpentyl)carbamimidoyl]benzamide (PubChem CID 22149344) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-methyl-N-[N'-(5-phenylpentyl)carbamimidoyl]benzamide.
| Compound Name | 4-methyl-N-[N'-(5-phenylpentyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 22149344 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-methyl-N-[N'-(5-phenylpentyl)carbamimidoyl]benzamide |
| SMILES | Cc1ccc(C(=O)N/C(N)=N/CCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-16-11-13-18(14-12-16)19(24)23-20(21)22-15-7-3-6-10-17-8-4-2-5-9-17/h2,4-5,8-9,11-14H,3,6-7,10,15H2,1H3,(H3,21,22,23,24) |
| InChIKey | HSVNNPJEZQWEKQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|