About N,N-dichloro-1,3,5-triazin-2-amine
N,N-dichloro-1,3,5-triazin-2-amine (PubChem CID 22149670) has the molecular formula C3H2Cl2N4
and a molecular weight of 164.98 g/mol. Its IUPAC name is N,N-dichloro-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | N,N-dichloro-1,3,5-triazin-2-amine |
| PubChem CID | 22149670 |
| Molecular Formula | C3H2Cl2N4 |
| Molecular Weight | 164.98 g/mol |
| Exact Mass | 163.97 |
| IUPAC Name | N,N-dichloro-1,3,5-triazin-2-amine |
| SMILES | ClN(Cl)c1ncncn1 |
| InChI | InChI=1S/C3H2Cl2N4/c4-9(5)3-7-1-6-2-8-3/h1-2H |
| InChIKey | LOPXPCGSLMXROF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.98 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dichloro-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dichloro-1,3,5-triazin-2-amine?
The IUPAC name of N,N-dichloro-1,3,5-triazin-2-amine (CID 22149670) is N,N-dichloro-1,3,5-triazin-2-amine.
What is the SMILES notation for N,N-dichloro-1,3,5-triazin-2-amine?
The canonical SMILES for N,N-dichloro-1,3,5-triazin-2-amine is ClN(Cl)c1ncncn1.
What is the InChIKey of N,N-dichloro-1,3,5-triazin-2-amine?
The InChIKey is LOPXPCGSLMXROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2Cl2N4/c4-9(5)3-7-1-6-2-8-3/h1-2H.
What are the key properties of N,N-dichloro-1,3,5-triazin-2-amine?
N,N-dichloro-1,3,5-triazin-2-amine has a molecular weight of 164.98 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dichloro-1,3,5-triazin-2-amine is sourced from PubChem (CID 22149670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).