C27H20ClFN4O11 — CID 22150323
ethyl 1-[3-[(4-acetyloxy-5-chloro-2-pyridinyl)oxycarbonyl]benzoyl]-5-fluoro-4-[(E)-furan-2-ylmethylideneamino]oxy-2,6-dioxo-1,3-diazinane-5-carboxylate (PubChem CID 22150323) has the molecular formula C27H20ClFN4O11 and a molecular weight of 630.93 g/mol. Its IUPAC name is ethyl 1-[3-[(4-acetyloxy-5-chloro-2-pyridinyl)oxycarbonyl]benzoyl]-5-fluoro-4-[(E)-furan-2-ylmethylideneamino]oxy-2,6-dioxo-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl 1-[3-[(4-acetyloxy-5-chloro-2-pyridinyl)oxycarbonyl]benzoyl]-5-fluoro-4-[(E)-furan-2-ylmethylideneamino]oxy-2,6-dioxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 22150323 |
| Molecular Formula | C27H20ClFN4O11 |
| Molecular Weight | 630.93 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | ethyl 1-[3-[(4-acetyloxy-5-chloro-2-pyridinyl)oxycarbonyl]benzoyl]-5-fluoro-4-[(E)-furan-2-ylmethylideneamino]oxy-2,6-dioxo-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)C1(F)C(=O)N(C(=O)c2cccc(C(=O)Oc3cc(OC(C)=O)c(Cl)cn3)c2)C(=O)NC1O/N=C/c1ccco1 |
| InChI | InChI=1S/C27H20ClFN4O11/c1-3-40-25(38)27(29)23(44-31-12-17-8-5-9-41-17)32-26(39)33(24(27)37)21(35)15-6-4-7-16(10-15)22(36)43-20-11-19(42-14(2)34)18(28)13-30-20/h4-13,23H,3H2,1-2H3,(H,32,39)/b31-12+ |
| InChIKey | PGJDVPWCLPEFSC-KLPHOBTLSA-N |
| XLogP | 2.81 |
| TPSA | 193.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|