About diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate
diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate (PubChem CID 2215050) has the molecular formula C14H18N4O4
and a molecular weight of 306.32 g/mol. Its IUPAC name is diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate |
| PubChem CID | 2215050 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)N(C#N)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H18N4O4/c1-5-21-12(19)11(13(20)22-6-2)18(8-15)14-16-9(3)7-10(4)17-14/h7,11H,5-6H2,1-4H3 |
| InChIKey | MVTLLJNVWBPCEY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 105.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate?
The IUPAC name of diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate (CID 2215050) is diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate.
What is the SMILES notation for diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate?
The canonical SMILES for diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate is CCOC(=O)C(C(=O)OCC)N(C#N)c1nc(C)cc(C)n1.
What is the InChIKey of diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate?
The InChIKey is MVTLLJNVWBPCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O4/c1-5-21-12(19)11(13(20)22-6-2)18(8-15)14-16-9(3)7-10(4)17-14/h7,11H,5-6H2,1-4H3.
What are the key properties of diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate?
diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate has a molecular weight of 306.32 g/mol, XLogP of 0.88, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]propanedioate is sourced from PubChem (CID 2215050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).