About 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate
4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate (PubChem CID 22150763) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate.
Molecular Properties
| Compound Name | 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate |
| PubChem CID | 22150763 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate |
| SMILES | CC(=O)OC(C)C#CC12OC1(C)CCC2(C)C |
| InChI | InChI=1S/C14H20O3/c1-10(16-11(2)15)6-7-14-12(3,4)8-9-13(14,5)17-14/h10H,8-9H2,1-5H3 |
| InChIKey | AMTOTWQSXDGEIP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate?
The IUPAC name of 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate (CID 22150763) is 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate.
What is the SMILES notation for 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate?
The canonical SMILES for 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate is CC(=O)OC(C)C#CC12OC1(C)CCC2(C)C.
What is the InChIKey of 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate?
The InChIKey is AMTOTWQSXDGEIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-10(16-11(2)15)6-7-14-12(3,4)8-9-13(14,5)17-14/h10H,8-9H2,1-5H3.
What are the key properties of 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate?
4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate has a molecular weight of 236.31 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,5-trimethyl-6-oxabicyclo[3.1.0]hexan-1-yl)but-3-yn-2-yl acetate is sourced from PubChem (CID 22150763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).